CAS 179866-74-1: (R)-(+)-6,6'-DIBROMO-2,2'-BIS(METHOXYMETHOXY)-1,1'-BINAPHTHYL
Description:(R)-(+)-6,6'-Dibromo-2,2'-bis(methoxymethoxy)-1,1'-binaphthyl is a chiral organic compound notable for its application in asymmetric synthesis and catalysis. This compound features a binaphthyl backbone, which contributes to its rigidity and stereochemical properties, making it an effective ligand in various catalytic reactions. The presence of two bromine atoms enhances its reactivity, while the methoxymethoxy groups provide solubility and steric hindrance, which can influence the selectivity of reactions. The specific stereochemistry denoted by (R)-(+)- indicates that it has a right-handed configuration, which is crucial for its function in chiral environments. This compound is typically used in the synthesis of pharmaceuticals and fine chemicals, where chirality is essential for biological activity. Its unique structural features allow it to participate in various chemical transformations, making it a valuable tool in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C24H20Br2O4
InChI:InChI=1/C24H20Br2O4/c1-27-13-29-21-9-3-15-11-17(25)5-7-19(15)23(21)24-20-8-6-18(26)12-16(20)4-10-22(24)30-14-28-2/h3-12H,13-14H2,1-2H3
- Synonyms:
- 6,6'-Dibromo-2,2'-Bis(Methoxymethoxy)-1,1'-Binaphthyl
- (R)-(+)-6,6'-Dibromo-2,2'-Bis(Methoxymethoxybinaphthalene)
- (S)-(-)-6,6'-Dibromo-2,2'-Bis(Methoxymethoxy)-1,1'-Binaphthalene
- (S)-(-)-6,6'-Dibromo-2,2'-Bis(Methoxymethoxy)-1,1'-Binaphthyl
- (R)-6,6'-Dibromo-2,2'-Bis(Methoxymethox&
- 6,6'-Dibromo-2,2'-Bis(Methoxymethoxy)-1,1'-Binaphthalene
- (R)-6,6'-DIBROMO-2,2'-BIS(METHOXYMETHOXY)-1,1'-BINAPHTHYL

(R)-6,6'-Dibromo-2,2'-bis(methoxymethoxy)-1,1'-binaphthyl
Ref: 3B-D4882
1g | 104.00 € | ||
5g | 359.00 € |

(R)-(+)-6,6'-Dibromo-2,2'-bis(methoxymethoxy)-1,1'-binaphthyl, min. 98%
Ref: 08-08-0620
1g | 267.00 € | ||
250mg | 92.00 € |

1,1'-Binaphthalene, 6,6'-dibromo-2,2'-bis(methoxymethoxy)-, (1R)-
Ref: IN-DA0027B9
1g | 69.00 € | ||
5g | 200.00 € | ||
25g | 511.00 € | ||
250mg | 33.00 € |

(R)-(+)-6,6-Dibromo-2,2-Bis(Methoxymethoxy)-1,1-Binaphthyl
Ref: 54-OR1008410
1g | 47.00 € | ||
5g | 185.00 € | ||
25g | 591.00 € | ||
100g | 1,929.00 € | ||
250mg | 32.00 € |

(R)-(+)-6,6'-Dibromo-2,2'-bis(methoxymethoxy)-1,1'-binaphthalene, min. 98% (99% ee)
Ref: 08-08-0152
100mg | 97.00 € | ||
500mg | 398.00 € |

(R)-6,6'-Dibromo-2,2'-bis(methoxymethoxy)-1,1'-binaphthyl
Ref: 3D-FD21573
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
500mg | Discontinued | Request information |