CAS 179873-46-2

6-(Dimethylamino)-N-methyl-3-pyridinemethanamine

Description:

6-(Dimethylamino)-N-methyl-3-pyridinemethanamine, with the CAS number 179873-46-2, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a dimethylamino group and a methyl group attached to the nitrogen atom, contributing to its basicity and potential reactivity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. The presence of the pyridine moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods or referenced from chemical databases for precise applications.

Formula: C₉H₁₅N₃

InChI: InChI=1S/C9H15N3/c1-10-6-8-4-5-9(11-7-8)12(2)3/h4-5,7,10H,6H2,1-3H3

InChI key: InChIKey=NODIHALEAFJFBX-UHFFFAOYSA-N

SMILES: N(C)(C)C1=CC=C(CNC)C=N1

Synonyms:

• 6-(Dimethylamino)-N-methyl-3-pyridinemethanamine
• 3-Pyridinemethanamine, 6-(dimethylamino)-N-methyl-

N,N-Dimethyl-5-[(methylamino)methyl]pyridin-2-amine

CAS: 179873-46-2

Versatile small molecule scaffold

Formula: C₉H₁₅N₃

Purity: Min. 95%

Molecular weight: 165.24 g/mol

Ref: 3D-EHA87346