CymitQuimica logo

CAS 17988-79-3

:

3,5-BIS-(CHLOROMETHYL)OCTAMETHYLTETRASILOXANE

Description:
3,5-Bis(chloromethyl)octamethyl-tetrasiloxane, with the CAS number 17988-79-3, is a siloxane compound characterized by its unique siloxane backbone, which consists of alternating silicon and oxygen atoms. This compound features chloromethyl groups attached to the 3 and 5 positions of the siloxane chain, enhancing its reactivity and potential applications in various chemical processes. The presence of octamethyl groups contributes to its hydrophobic properties and thermal stability, making it suitable for use in silicone-based materials. Typically, siloxanes exhibit low surface tension, good thermal stability, and resistance to moisture, which can be advantageous in applications such as coatings, sealants, and adhesives. Additionally, the chloromethyl groups can facilitate further chemical modifications, allowing for the synthesis of more complex siloxane derivatives. Safety considerations should be taken into account due to the presence of chloromethyl groups, which can be reactive and potentially hazardous. Overall, this compound is of interest in both industrial and research settings for its versatile properties and potential applications in silicone chemistry.
Formula:C10H28Cl2O3Si4
InChI:InChI=1/C10H28Cl2O3Si4/c1-16(2,9-11)13-18(5,6)15-19(7,8)14-17(3,4)10-12/h9-10H2,1-8H3
SMILES:C[Si](C)(CCl)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCl
Synonyms:
  • Chloromethyl-[[[Chloromethyl(Dimethyl)Silyl]Oxy-Dimethyl-Silyl]Oxy-Dimethyl-Silyl]Oxy-Dimethyl-Silane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.