CymitQuimica logo

CAS 179897-94-0

:

5-Fluoro-2-methoxyphenylboronic acid

Description:
5-Fluoro-2-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a fluorine atom and a methoxy group attached to a phenyl ring, which can influence its reactivity and solubility. The presence of the boronic acid group imparts acidic properties, allowing it to participate in acid-base reactions. Typically, boronic acids are stable under ambient conditions but can be sensitive to moisture and air, requiring careful handling. This compound is often utilized in medicinal chemistry and materials science for the synthesis of complex organic molecules and in the development of pharmaceuticals. Its unique structural features contribute to its potential applications in drug discovery and organic synthesis, making it a valuable building block in various chemical processes.
Formula:C7H8BFO3
InChI:InChI=1S/C7H8BFO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4,10-11H,1H3
InChI key:InChIKey=CCQKIRUMTHHPSX-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(OC)C=CC(F)=C1
Synonyms:
  • (5-Fluoro-2-Hydroxyphenyl)Boronic Acid
  • (5-Fluoro-2-methoxyphenyl)boronic acid
  • 2-Methoxy-5-Fluorobenzeneboronic Acid
  • 2-Methoxy-5-Fluorophenylboronic Acid
  • 5-Fluoro-2-Methoxybenzeneboronic Acid
  • B-(5-Fluoro-2-methoxyphenyl)boronic acid
  • Boronic acid, (5-fluoro-2-methoxyphenyl)-
  • Boronic acid, B-(5-fluoro-2-methoxyphenyl)-
  • 5-Fluoro-2-methoxyphenylboronic acid
Found 7 products.