CAS 179899-07-1
:4-Fluoro-2-methoxyphenylboronic acid
Description:
4-Fluoro-2-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that also contains a fluorine atom and a methoxy group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure features a boron atom bonded to a phenyl ring, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially enhancing its biological activity or altering its interaction with biological targets. Additionally, the methoxy group can affect solubility and reactivity, making this compound of interest in the development of pharmaceuticals and agrochemicals. As with many boronic acids, it can form stable complexes with diols, which is a key feature in applications such as sensing and drug delivery.
Formula:C7H8BFO3
InChI:InChI=1/C7H8BFO3/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4,10-11H,1H3
SMILES:COc1cc(ccc1B(O)O)F
Synonyms:- 2-Methoxy-4-Fluorophenylboronic Acid
- 4-Fluoro-2-Methoxybenzeneboronic Acid
- Akos Brn-0234
- 4-Fluoro-2-Formylphenylboronic Acid
- 4-Fluoro-2-Methoxyphenylboroni
- 5-Fluoroanisole-2-boronic acid
- (4-Fluoro-2-methoxyphenyl)boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Fluoro-2-methoxyphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H8BFO3Purity:97.0 to 111.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:169.95Boronic acid, B-(4-fluoro-2-methoxyphenyl)-
CAS:Formula:C7H8BFO3Purity:98%Color and Shape:SolidMolecular weight:169.94604-Fluoro-2-methoxyphenylboronic acid
CAS:Formula:C7H8BFO3Purity:≥ 98.0%Color and Shape:Off-white powderMolecular weight:169.954-Fluoro-2-methoxybenzeneboronic acid
CAS:<p>4-Fluoro-2-methoxybenzeneboronic acid</p>Formula:C7H8BFO3Purity:98%Color and Shape: white solidMolecular weight:169.95g/mol4-Fluoro-2-methoxyphenylboronic acid
CAS:Formula:C7H8BFO3Purity:98%Color and Shape:SolidMolecular weight:169.95




