CAS 1799-90-2

Bis(pentafluorophenyl)zinc

Description:

Bis(pentafluorophenyl)zinc, with the CAS number 1799-90-2, is an organozinc compound characterized by its unique structure, which features two pentafluorophenyl groups bonded to a central zinc atom. This compound is notable for its high reactivity and is often utilized in organic synthesis, particularly in reactions involving carbon-carbon bond formation. The presence of the highly electronegative fluorine atoms in the pentafluorophenyl groups imparts significant stability to the compound while also enhancing its electrophilic character. Bis(pentafluorophenyl)zinc is typically a solid at room temperature and can be sensitive to moisture and air, necessitating careful handling under inert atmospheres. Its applications extend to the fields of materials science and catalysis, where it serves as a precursor for various organometallic reactions. Additionally, due to its unique electronic properties, it has garnered interest in the development of advanced materials and pharmaceuticals. Overall, bis(pentafluorophenyl)zinc is a valuable compound in synthetic chemistry, offering a versatile platform for the exploration of new chemical transformations.

Formula: C₁₂F₁₀Zn

InChI: InChI=1/2C6F5.Zn/c2*7-2-1-3(8)5(10)6(11)4(2)9;/q2*-1;+2

SMILES: C1=C(C(=C([C-](C=1F)F)F)F)F.C1=C(C(=C([C-](C=1F)F)F)F)F.[Zn]

Synonyms:

• Zinc Bis(Pentafluorobenzenide)

Bis(Pentafluorophenyl)Zinc

CAS: 1799-90-2

Bis(Pentafluorophenyl)Zinc

Purity: ≥95%

Molecular weight: 399.506g/mol

Ref: 54-PC109914

Bis(pentafluorophenyl)zinc

CAS: 1799-90-2

Bis(pentafluorophenyl)zinc (BPFPZn) is a ring-opening polymerization catalyst that is used to synthesize polymers with pendant covalent adducts. BPFPZn has shown synergistic effects when used in combination with lactide, which is a monomer that can be polymerized to form polylactic acid. The reaction system used for the synthesis of BPFPZn and lactide involves nucleophilic attack on the zinc cation by the carbonyl group of lactide, leading to reductive elimination and coordination chemistry. This reaction system has been shown to produce architectures such as block copolymers and star polymers.

Formula: C₁₂F₁₀Zn

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 399.49 g/mol

Ref: 3D-FB78195

Zinc, bis(2,3,4,5,6-pentafluorophenyl)-

CAS: 1799-90-2

Formula: C₁₂F₁₀Zn

Purity: 97%

Color and Shape: Solid

Molecular weight: 399.4924

Ref: IN-DA0027DL