CAS 17994-25-1
:1-hydroxy-1-cyclopropanecarboxylic acid
Description:
1-Hydroxy-1-cyclopropanecarboxylic acid is an organic compound characterized by its cyclopropane structure, which features a carboxylic acid group and a hydroxyl group attached to the same carbon atom. This unique arrangement contributes to its reactivity and potential applications in organic synthesis. The presence of the hydroxyl group enhances its solubility in polar solvents, while the carboxylic acid group can participate in various chemical reactions, such as esterification and acid-base reactions. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure allows for interesting stereochemical properties, which can influence its behavior in biological systems. Additionally, 1-hydroxy-1-cyclopropanecarboxylic acid may serve as an intermediate in the synthesis of more complex molecules, making it valuable in pharmaceutical and agrochemical research. As with many organic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.
Formula:C4H5O3
InChI:InChI=1/C4H6O3/c5-3(6)4(7)1-2-4/h7H,1-2H2,(H,5,6)/p-1
SMILES:C1CC1(C(=O)[O-])O
Synonyms:- Methyl 3-[dichloro(methyl)silyl]propanoate
- Propanoic acid, 3-(dichloromethylsilyl)-, methyl ester
- 1-Hydroxycyclopropanecarboxylate
- 1-Hydroxycyclopropanecarboxylic Acid
- 1-Hydroxycyclopropane-1-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Hydroxycyclopropanecarboxylic Acid
CAS:Formula:C4H6O3Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:102.09Cyclopropanecarboxylic acid, 1-hydroxy-
CAS:Formula:C4H6O3Purity:97%Color and Shape:SolidMolecular weight:102.08861-Hydroxycyclopropane-1-carboxylic acid
CAS:1-Hydroxycyclopropane-1-carboxylic acidFormula:C4H6O3Purity:98%Color and Shape: faint yellow crystalline solidMolecular weight:102.09g/mol1-Hydroxy-1-cyclopropanecarboxylic acid
CAS:Formula:C4H6O3Purity:97%Color and Shape:SolidMolecular weight:102.089



