CAS 179942-45-1
:6-T-BUTYLDIMETHYSILYLOXY-2-NAPHTHALENEBORONIC ACID
Description:
6-T-Butyldimethylsilyloxy-2-naphthaleneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a naphthalene ring, which is further modified by a t-butyldimethylsilyloxy group. This compound typically exhibits properties such as good solubility in organic solvents, making it useful in various organic synthesis applications, particularly in cross-coupling reactions like Suzuki-Miyaura coupling. The boronic acid moiety allows for the formation of stable complexes with diols and other Lewis bases, which can be exploited in sensor applications or as intermediates in the synthesis of more complex molecules. Additionally, the presence of the silyloxy group can enhance the stability and reactivity of the compound under certain conditions. Overall, this compound is valuable in synthetic organic chemistry and materials science, particularly in the development of pharmaceuticals and advanced materials.
Formula:C16H23BO3Si
InChI:InChI=1/C16H23BO3Si/c1-16(2,3)21(4,5)20-15-9-7-12-10-14(17(18)19)8-6-13(12)11-15/h6-11,18-19H,1-5H3
SMILES:CC(C)(C)[Si](C)(C)Oc1ccc2cc(ccc2c1)B(O)O
Synonyms:- Akos Brn-0555
- 6-T-Butyldimethylsilyloxy-2-Naphthyleneboronic Acid
- 6-T-Butyldimethysilyloxynaphthalene-2-Boronic Acid
- 6-Tert-Butyldimethylsilyloxy-2-Naphthaleneboronic Acid
- 6-TBDMSO-2-naphthaleneboronic acid
- 6-t-Butyldimethylsilyloxy-2-naphthaleneboronic acid
- 6-T-Butyldimethylsilyloxy-2-Naphtaleneboronic Acid
- (6-{[Tert-Butyl(Dimethyl)Silyl]Oxy}Naphthalen-2-Yl)Boronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-t-Butyldimethylsilyloxy-2-naphthaleneboronic acid
CAS:Formula:C16H23BO3SiPurity:98%Color and Shape:SolidMolecular weight:302.24856-(tert-Butyl)dimethysilyloxynaphthalene-2-boronic acid
CAS:6-(tert-Butyl)dimethysilyloxynaphthalene-2-boronic acidPurity:95%Molecular weight:302.25g/mol2-(tert-Butyldimethylsilyloxy)naphthalene-6-boronic acid
CAS:2-(tert-Butyldimethylsilyloxy)naphthalene-6-boronic acid is a receptor modulator that is a boronate ester. It has estrogenic activity and may be used as an estrogen receptor modulator. 2-(tert-Butyldimethylsilyloxy)naphthalene-6-boronic acid binds to the estrogen receptor, which alters its structure and function. This leads to the activation of transcription factors that regulate gene expression. 2-(tert-Butyldimethylsilyloxy)naphthalene-6-boronic acid has been shown to inhibit proliferation of human breast cancer cells (MCF7). The phenyl group on the naphthalene ring may be responsible for this effect.Formula:C16H23BO3SiPurity:Min. 95%Molecular weight:302.25 g/mol



