CAS 1799421-02-5
:Benzenamine, 5-bromo-2-ethyl-, hydrochloride (1:1)
Description:
Benzenamine, 5-bromo-2-ethyl-, hydrochloride (1:1) is an organic compound characterized by its amine functional group and a bromine substituent on the benzene ring. The presence of the ethyl group at the 2-position contributes to its hydrophobic characteristics, while the bromine atom enhances its reactivity, making it useful in various chemical syntheses. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in biological and chemical applications. This compound may exhibit properties such as basicity due to the amine group, and it can participate in nucleophilic substitution reactions. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, the compound's unique combination of functional groups and substituents makes it a subject of interest in both research and industrial contexts.
Formula:C8H10BrN·ClH
InChI:InChI=1S/C8H10BrN.ClH/c1-2-6-3-4-7(9)5-8(6)10;/h3-5H,2,10H2,1H3;1H
InChI key:InChIKey=ROHGJEBYFYCUPG-UHFFFAOYSA-N
SMILES:C(C)C1=C(N)C=C(Br)C=C1.Cl
Synonyms:- Benzenamine, 5-bromo-2-ethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
