
CAS 1799421-14-9
:Benzenemethanamine, 3-(2-oxazolyl)-, hydrochloride (1:1)
Description:
Benzenemethanamine, 3-(2-oxazolyl)-, hydrochloride (1:1), with the CAS number 1799421-14-9, is a chemical compound characterized by its unique structural features. It consists of a benzenemethanamine core substituted with a 2-oxazole ring, which contributes to its potential biological activity. The hydrochloride form indicates that the compound is a salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the oxazole ring suggests potential interactions with biological targets, possibly influencing its pharmacological properties. This compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for various functional group interactions, making it a candidate for research in medicinal chemistry. As with many amines, it may also exhibit basicity, influencing its behavior in different pH environments. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings.
Formula:C10H10N2O·ClH
InChI:InChI=1S/C10H10N2O.ClH/c11-7-8-2-1-3-9(6-8)10-12-4-5-13-10;/h1-6H,7,11H2;1H
InChI key:InChIKey=ONZXYLJUMSWHEH-UHFFFAOYSA-N
SMILES:C(N)C=1C=C(C=CC1)C2=NC=CO2.Cl
Synonyms:- Benzenemethanamine, 3-(2-oxazolyl)-, hydrochloride (1:1)
- (3-(Oxazol-2-yl)phenyl)methanamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3-(Oxazol-2-yl)phenyl)methanamine hydrochloride
CAS:Formula:C10H11ClN2OColor and Shape:SolidMolecular weight:210.6601
