CAS 17996-12-2
:6-(Z-amino)-1-hexanol
Description:
6-(Z-amino)-1-hexanol, with the CAS number 17996-12-2, is an organic compound characterized by its aliphatic structure featuring a hexanol backbone with an amino group at the sixth carbon position. This compound typically exhibits properties associated with both alcohols and amines, including the ability to form hydrogen bonds due to the presence of the hydroxyl (-OH) and amino (-NH2) functional groups. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the amino group suggests that it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, 6-(Z-amino)-1-hexanol may exhibit biological activity, potentially serving as a building block in the synthesis of more complex molecules or as an intermediate in pharmaceutical applications. Its solubility in water and organic solvents can vary, influencing its utility in different chemical contexts. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H21NO3
InChI:InChI=1/C14H21NO3/c16-11-7-2-1-6-10-15-14(17)18-12-13-8-4-3-5-9-13/h3-5,8-9,16H,1-2,6-7,10-12H2,(H,15,17)
SMILES:C(CCCO)CCN=C(O)OCc1ccccc1
Synonyms:- Benzyl (6-Hydroxyhexyl)Carbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
6-(N-Benzyloxycarbonylamino)-1-hexanol
CAS:Formula:C14H21NO3Purity:>98.0%(HPLC)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:251.33Carbamic acid, N-(6-hydroxyhexyl)-, phenylmethyl ester
CAS:Formula:C14H21NO3Purity:97%Color and Shape:SolidMolecular weight:251.3214Ref: IN-DA0021J9
1kgTo inquire5kgTo inquire250mg22.00€1g26.00€5g27.00€10g40.00€25g62.00€100g182.00€500g629.00€Benzyl (6-hydroxyhexyl)carbamate
CAS:Benzyl (6-hydroxyhexyl)carbamatePurity:98%Molecular weight:251.32g/mol6-(Z-Amino)-1-hexanol
CAS:Formula:C14H21NO3Purity:≥ 97.0%Color and Shape:White to off-white solidMolecular weight:251.32Cbz-6-aminohexan-1-ol
CAS:6-Aminohexanol is a glycosyl phosphorylated amino alcohol that is an important intermediate in organic chemistry. It has been used to synthesize the capsular polysaccharide of Neisseria meningitidis serogroup B. This compound has tetrameric structure and was found to be stereoselective, with the alpha-isomer being more active than the beta-isomer. 6-Aminohexanol also has an anti-inflammatory effect, which may be due to its ability to inhibit prostaglandin synthesis. The molecular mechanism for this inhibition is not clear yet.Formula:C14H21NO3Purity:Min. 97 Area-%Color and Shape:White Yellow PowderMolecular weight:251.32 g/molN-Cbz-6-Amino-hexan-1-ol
CAS:Formula:C14H21NO3Purity:95%Color and Shape:SolidMolecular weight:251.326





