CAS 179993-02-3

(R)-((2-(Bromomethyl)-3-methylbutoxy)methyl)benzene

Description:

(R)-((2-(Bromomethyl)-3-methylbutoxy)methyl)benzene, identified by its CAS number 179993-02-3, is an organic compound characterized by its complex structure that includes a benzene ring substituted with a bromomethyl group and a branched alkoxy side chain. The presence of the bromomethyl group indicates potential reactivity, particularly in nucleophilic substitution reactions. The compound's chirality, denoted by the (R) configuration, suggests that it may exhibit specific stereochemical properties, which can influence its biological activity and interactions with other molecules. The alkoxy group contributes to the compound's solubility and polarity, affecting its behavior in various solvents. Additionally, the presence of the methyl groups in the side chain can impact steric hindrance and overall molecular stability. Such compounds may find applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, where their unique structural features can be leveraged for specific chemical transformations or biological activities.

Formula: C₁₃H₁₉BrO

InChI: InChI=1/C13H19BrO/c1-11(2)13(8-14)10-15-9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3/t13-/m0/s1

SMILES: CC(C)[C@@H](CBr)COCc1ccccc1

Benzene, [[(2R)-2-(bromomethyl)-3-methylbutoxy]methyl]-

CAS: 179993-02-3

Formula: C₁₃H₁₉BrO

Purity: 98%

Molecular weight: 271.1934

Ref: IN-DA0021K8

(R)-((2-(bromomethyl)-3-methylbutoxy)methyl)benzene

CAS: 179993-02-3

Purity: 98%

Molecular weight: 271.197998

Ref: 10-F733317