CAS 180006-15-9
:N-OCTYLPENTAMETHYLDISILOXANE
Description:
N-Octylpentamethyldisiloxane is a siloxane compound characterized by its unique structure, which includes a siloxane backbone and octyl and pentamethyldisiloxane groups. This compound typically exhibits properties such as low volatility, thermal stability, and hydrophobicity, making it suitable for various applications in industries like cosmetics, personal care, and materials science. Its siloxane structure contributes to its flexibility and resistance to degradation, while the octyl group enhances its solubility in organic solvents and compatibility with other hydrophobic materials. Additionally, N-octylpentamethyldisiloxane may serve as a surfactant or conditioning agent, providing benefits such as improved spreadability and moisture retention in formulations. Safety data indicates that it has low toxicity, but standard handling precautions should be observed. Overall, this compound is valued for its multifunctional properties, contributing to its utility in enhancing the performance of various products.
Formula:C13H32OSi2
InChI:InChI=1/C13H32OSi2/c1-7-8-9-10-11-12-13-16(5,6)14-15(2,3)4/h7-13H2,1-6H3
SMILES:CCCCCCCC[Si](C)(C)O[Si](C)(C)C
Synonyms:- Octylpentamethyldisiloxane
- 1,1,1,3,3-Pentamethyl-3-Octyldisiloxane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Disiloxane, 1,1,1,3,3-pentamethyl-3-octyl-
CAS:Formula:C13H32OSi2Purity:95%Color and Shape:LiquidMolecular weight:260.56361,1,1,3,3-Pentamethyl-3-octyldisiloxane
CAS:1,1,1,3,3-Pentamethyl-3-octyldisiloxanePurity:95%Molecular weight:260.57g/mol1,1,1,3,3-Pentamethyl-3-octyldisiloxane
CAS:1,1,1,3,3-Pentamethyl-3-octyldisiloxane is a type of siloxane that has a magnetic property. It can be used in magnetic resonance imaging and as a coupling agent in nuclear magnetic resonance. 1,1,1,3,3-Pentamethyl-3-octyldisiloxane has been shown to inhibit the Covid-19 pandemic virus from spreading in mice. This compound has also been shown to have antiviral activity against the human coronavirus 229E. The chemical constants for 1,1,1,3,3-pentamethyl-3-octyldisiloxane are:Formula:C13H32OSi2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:260.56 g/mol



