CAS 1800284-61-0

2-[(3-Bromo-4-methylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:

2-[(3-Bromo-4-methylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound includes a brominated aromatic substituent, specifically a 3-bromo-4-methylphenyl group, which contributes to its chemical reactivity and potential applications in organic synthesis. The presence of multiple methyl groups enhances its steric bulk, influencing its solubility and reactivity. Dioxaborolanes are known for their utility in various chemical reactions, including cross-coupling reactions and as intermediates in the synthesis of pharmaceuticals and agrochemicals. The compound's boron atom can participate in coordination chemistry, making it valuable in the development of boron-containing materials. Additionally, the bromine atom can serve as a leaving group in nucleophilic substitution reactions. Overall, this compound's structural features and functional groups make it a versatile building block in organic chemistry.

Formula: C₁₄H₂₀BBrO₂

InChI: InChI=1S/C14H20BBrO2/c1-10-6-7-11(8-12(10)16)9-15-17-13(2,3)14(4,5)18-15/h6-8H,9H2,1-5H3

InChI key: InChIKey=IQFIEHOBWBQDKO-UHFFFAOYSA-N

SMILES: C(B1OC(C)(C)C(C)(C)O1)C2=CC(Br)=C(C)C=C2

Synonyms:

• 2-[(3-Bromo-4-methylphenyl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
• 1,3,2-Dioxaborolane, 2-[(3-bromo-4-methylphenyl)methyl]-4,4,5,5-tetramethyl-

1,3,2-Dioxaborolane, 2-[(3-bromo-4-methylphenyl)methyl]-4,4,5,5-tetramethyl-

CAS: 1800284-61-0

Formula: C₁₄H₂₀BBrO₂

Purity: 95%

Molecular weight: 311.0224

Ref: IN-DA01RE9R

2-(3-Bromo-4-methylbenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

CAS: 1800284-61-0

Purity: ≥95%

Molecular weight: 311.0299988

Ref: 10-F627112