CAS 180048-75-3

cyclopentyl[4-(methylsulfanyl)phenyl]methanone

Description:

Cyclopentyl[4-(methylsulfanyl)phenyl]methanone, with the CAS number 180048-75-3, is an organic compound characterized by its unique structure that includes a cyclopentyl group and a phenyl ring substituted with a methylsulfanyl group. This compound typically exhibits properties common to ketones, such as being a liquid or solid at room temperature, depending on its molecular weight and structure. It may have moderate solubility in organic solvents and limited solubility in water due to the presence of hydrophobic groups. The methylsulfanyl group can influence its reactivity and polarity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions or electrophilic additions. Additionally, the presence of the cyclopentyl moiety may impart unique steric and electronic effects, affecting the compound's overall stability and reactivity. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.

Formula: C₁₃H₁₆OS

InChI: InChI=1/C13H16OS/c1-15-12-8-6-11(7-9-12)13(14)10-4-2-3-5-10/h6-10H,2-5H2,1H3

SMILES: CSc1ccc(cc1)C(=O)C1CCCC1

cyclopentyl 4-thiomethylphenyl ketone

CAS: 180048-75-3

Formula: C₁₃H₁₆OS

Purity: 97.0%

Molecular weight: 220.33

Ref: 10-F204118