CAS 180059-04-5
:1H-Pyrrole-2,4-dicarboxylicacid,3-amino-,dimethylester(9CI)
Description:
1H-Pyrrole-2,4-dicarboxylic acid, 3-amino-, dimethyl ester (CAS 180059-04-5) is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two carboxylic acid groups and an amino group, contributing to its potential reactivity and solubility in various solvents. The dimethyl ester functionality indicates that the carboxylic acid groups are esterified with methyl groups, which can influence its physical properties, such as boiling point and solubility. The presence of the amino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, making it a candidate for applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the compound may exhibit biological activity due to its structural features, which could be explored in medicinal chemistry. Overall, its unique structure and functional groups make it a versatile compound in chemical research and development.
Formula:C8H10N2O4
InChI:InChI=1/C8H10N2O4/c1-13-7(11)4-3-10-6(5(4)9)8(12)14-2/h3,10H,9H2,1-2H3
SMILES:COC(=O)c1c[nH]c(c1N)C(=O)OC
Synonyms:- dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,4-Dimethyl 3-amino-1h-pyrrole-2,4-dicarboxylate
CAS:Formula:C8H10N2O4Purity:95%Molecular weight:198.17602,4-Dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate
CAS:<p>2,4-Dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate</p>Formula:C8H10N2O4Purity:97%Color and Shape: off-white powderMolecular weight:198.18g/mol2,4-Dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate
CAS:<p>2,4-Dimethyl 3-amino-1H-pyrrole-2,4-dicarboxylate is an inhibitor of the enzyme formamidine acetate N-formyltransferase. This compound has been shown to inhibit bacterial growth in vitro and in vivo, and is being investigated as a potential antibacterial agent. 2,4-Dimethyl 3-amino-1H-pyrrole-2,4,-dicarboxylate inhibits the synthesis of formamidines by blocking the enzyme formamidine acetate N-formyltransferase. Formamidines are important for bacterial cell wall synthesis and cell division. This compound also inhibits the growth of methicillin resistant Staphylococcus aureus (MRSA) isolates.</p>Formula:C8H10N2O4Purity:Min. 95%Molecular weight:198.18 g/mol


