CAS 180084-26-8
:(1'-methyl-6,7-dihydro-5H-spiro[furo[2,3-f]indole-3,4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methanone hydrochloride (1:1)
Description:
The chemical substance with the name "(1'-methyl-6,7-dihydro-5H-spiro[furo[2,3-f]indole-3,4'-piperidin]-5-yl)[2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methanone hydrochloride (1:1)" and CAS number "180084-26-8" is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both indole and piperidine moieties. This compound features multiple functional groups, including a methanone and an oxadiazole, contributing to its potential biological activity. The presence of the hydrochloride salt form indicates enhanced solubility in aqueous environments, which is often advantageous for pharmacological applications. The intricate arrangement of its molecular framework suggests potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its properties would be assessed through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound exemplifies the complexity and diversity of modern organic compounds used in research and drug development.
Formula:C32H33ClN4O3
InChI:InChI=1/C32H32N4O3.ClH/c1-20-16-25(30-33-21(2)39-34-30)8-9-26(20)22-4-6-23(7-5-22)31(37)36-13-10-24-17-29-27(18-28(24)36)32(19-38-29)11-14-35(3)15-12-32;/h4-9,16-18H,10-15,19H2,1-3H3;1H
SMILES:Cc1cc(ccc1c1ccc(cc1)C(=O)N1CCc2cc3c(cc12)C1(CCN(C)CC1)CO3)c1nc(C)on1.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
SB-224289 Hyrochloride
CAS:SB-224289 is a drug that belongs to the class of 5-HT1A receptor agonists. It has been shown to have clinical relevance for the prognosis of locomotor activity and carcinoid syndrome. SB-224289 is a potent antagonist of the CB2 receptor, which may be used in the treatment of metastatic colorectal cancer. The drug also binds to 5-HT1A receptors, stabilizing them and preventing them from being degraded. SB-224289 provides evidence that 5-HT1A receptors are involved in carcinoid syndrome and can predict the development of carcinoid syndrome based on their binding affinity for this drug. It has been shown that SB-224289 does not bind to any other receptors, such as dopamine D2 or serotonin S2a receptors.Formula:C32H32N4O3·HClPurity:Min. 95%Molecular weight:520.62 g/molSB-224289 hydrochloride
CAS:SB-224289 hydrochloride (SB-224289A) is a selective antagonist of 5-HT1B receptor, with anxiolytic effect.Formula:C32H33ClN4O3Purity:98.99% - 99.96%Color and Shape:SolidMolecular weight:557.08



