CAS 1801335-68-1

4-Chloro-2-(5-chloro-2-fluorophenyl)-5-(1-methylethenyl)pyridine

Description:

4-Chloro-2-(5-chloro-2-fluorophenyl)-5-(1-methylethenyl)pyridine is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of chlorine and fluorine atoms contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The compound features a vinyl group, which may enhance its ability to participate in various chemical reactions, such as electrophilic substitutions or polymerization processes. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. The presence of halogens often enhances lipophilicity, which can affect the compound's solubility and permeability in biological systems. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the pyridine ring. Overall, 4-Chloro-2-(5-chloro-2-fluorophenyl)-5-(1-methylethenyl)pyridine represents a class of compounds that may exhibit significant interest in medicinal chemistry and material science.

Formula: C₁₄H₁₀Cl₂FN

InChI: InChI=1S/C14H10Cl2FN/c1-8(2)11-7-18-14(6-12(11)16)10-5-9(15)3-4-13(10)17/h3-7H,1H2,2H3

InChI key: InChIKey=LICNVQCUUJKYJN-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(Cl)=C(C(C)=C)C=N2)C=C(Cl)C=C1

Synonyms:

• 4-Chloro-2-(5-chloro-2-fluorophenyl)-5-(1-methylethenyl)pyridine
• Pyridine, 4-chloro-2-(5-chloro-2-fluorophenyl)-5-(1-methylethenyl)-

4-CHLORO-2-(3-FLUOROPYRIDIN-2-YL)-5-ISOPROPYLPYRIMIDINE

CAS: 1801335-68-1

Formula: C₁₂H₁₁ClFN₃

Purity: 95.0%

Molecular weight: 251.69

Ref: 10-F530443