CAS 18014-95-4

4-Methoxy-6-benzofurancarboxylic acid

Description:

4-Methoxy-6-benzofurancarboxylic acid is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of a methoxy group (-OCH3) at the 4-position and a carboxylic acid group (-COOH) at the 6-position contributes to its chemical reactivity and solubility properties. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the hydrophilic nature of the carboxylic acid group. It may exhibit moderate to high stability under standard conditions but can be sensitive to strong acids or bases. The compound's functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₀H₈O₄

InChI: InChI=1S/C10H8O4/c1-13-8-4-6(10(11)12)5-9-7(8)2-3-14-9/h2-5H,1H3,(H,11,12)

InChI key: InChIKey=RBOYKBFMOKKKCD-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(C(O)=O)=C1)OC=C2

Synonyms:

• 4-Methoxy-6-benzofurancarboxylic acid
• 6-Benzofurancarboxylic acid, 4-methoxy-

4-methoxy-1-benzofuran-6-carboxylic acid

CAS: 18014-95-4

Formula: C₁₀H₈O₄

Molecular weight: 192.17

Ref: 10-F372192