CymitQuimica logo

CAS 180160-91-2

:

4-(4-Trifluoromethoxy-phenyl)-piperidine

Description:
4-(4-Trifluoromethoxy-phenyl)-piperidine, identified by its CAS number 180160-91-2, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a trifluoromethoxy group attached to a phenyl ring significantly influences its chemical properties, including its polarity and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, which is common for compounds with similar structures. The trifluoromethoxy group enhances the compound's lipophilicity and may contribute to its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of fluorine atoms can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Safety data sheets should be consulted for handling and toxicity information, as compounds with fluorinated groups can exhibit specific hazards. Overall, 4-(4-Trifluoromethoxy-phenyl)-piperidine is a compound of interest in various chemical research fields, particularly in the development of pharmaceuticals.
Formula:C12H14F3NO
InChI:InChI=1S/C12H14F3NO/c13-12(14,15)17-11-3-1-9(2-4-11)10-5-7-16-8-6-10/h1-4,10,16H,5-8H2
InChI key:FLWRTKZUGCVAGX-UHFFFAOYSA-N
SMILES:C1CNCCC1C2=CC=C(C=C2)OC(F)(F)F
Synonyms:
  • 1-(Piperidin-4-yl)-4-(trifluoromethoxy)benzene
  • 4-[4-(Trifluoromethoxy)phenyl]piperidine
  • 4-[4-(Trifluoromethoxy)phenyl]-piperidine
Found 4 products.