CAS 180163-82-0
:Decylmethoxydimethylsilane
Description:
Decylmethoxydimethylsilane is an organosilicon compound characterized by its silane structure, which includes a decyl group, methoxy groups, and dimethyl groups attached to a silicon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its hydrophobic properties, making it useful as a surface modifier and coupling agent in various applications, including coatings, adhesives, and sealants. Its molecular structure allows it to enhance adhesion between organic materials and inorganic surfaces, improving the durability and performance of products. Additionally, Decylmethoxydimethylsilane exhibits low volatility and good thermal stability, which contributes to its effectiveness in high-performance formulations. The presence of the methoxy group also allows for potential reactivity, enabling it to bond with other materials during curing processes. Overall, this compound is valued in industrial applications for its ability to improve surface characteristics and enhance material compatibility.
Formula:C13H30OSi
InChI:InChI=1/C13H30OSi/c1-5-6-7-8-9-10-11-12-13-15(3,4)14-2/h5-13H2,1-4H3
InChI key:InChIKey=IKIVNCRFEYCANR-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)[Si](OC)(C)C
Synonyms:- Decyl(Methoxy)Dimethylsilane
- Decyldimethylmethoxysilane
- Decylmethoxydimethylsilane
- Silane, decylmethoxydimethyl-
- N-DECYLDIMETHYLMETHOXYSILANE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
n-Decyldimethylmethoxysilane
CAS:S05535 - n-Decyldimethylmethoxysilane
Formula:C13H30OSiColor and Shape:LiquidMolecular weight:230.467
