CAS 180186-94-1: (+)-2,2'-METHYLENEBIS[(3AR,8AS)-3A,8A-DIHYDRO-8H-INDENO[1,2-D]OXAZOLE]
Description:(+)-2,2'-Methylenebis[(3aR,8aS)-3a,8a-dihydro-8H-indeno[1,2-d]oxazole] is a complex organic compound characterized by its unique bicyclic structure, which includes an indeno[1,2-d]oxazole moiety. This compound features a methylene bridge connecting two identical indeno-oxazole units, contributing to its potential biological activity. The stereochemistry indicated by the (3aR,8aS) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's reactivity and interactions with biological targets. Typically, such compounds may exhibit properties relevant to medicinal chemistry, including potential neuroprotective or anti-inflammatory effects, although specific biological activities would require empirical investigation. The presence of nitrogen and oxygen in the oxazole ring adds to the compound's polarity and may affect its solubility and interaction with other molecules. As with many organic compounds, the stability, reactivity, and potential applications of this substance would depend on its environment and the presence of other chemical species.
Formula:C21H18N2O2
InChI:InChI=1/C21H18N2O2/c1-3-7-14-12(5-1)9-16-20(14)22-18(24-16)11-19-23-21-15-8-4-2-6-13(15)10-17(21)25-19/h1-8,16-17,20-21H,9-11H2/t16-,17-,20+,21+/m0/s1
- Synonyms:
- [3Ar-[2(3'Ar*,8'As*),3'Aβ,8'Aβ]]-(+)-2,2'-Methylenebis[3A,8A-Dihydro-8H-Indeno[1,2-]Oxazole]
- (-)-2,2'-Methylenebis-[(3Ar,8As)-3A,8A-Dihydro-8H-Indeno[1,2-D]Oxazole] Ep
- (3aR,8aS,3a'R,8a'S)-2,2'-methanediylbis(8,8a-dihydro-3aH-indeno[1,2-d][1,3]oxazole)