CAS 1802-12-6
:Phytolaccagenin
Description:
Phytolaccagenin is a triterpenoid compound derived from the plant Phytolacca americana, commonly known as pokeweed. It is characterized by its complex structure, which includes multiple fused rings and hydroxyl groups, contributing to its biological activity. Phytolaccagenin exhibits various pharmacological properties, including anti-inflammatory, antiviral, and potential anticancer effects, making it of interest in medicinal chemistry. The compound is typically found in the form of a white to off-white crystalline solid and is soluble in organic solvents. Its molecular formula reflects a significant degree of saturation and functionalization, which is typical for triterpenoids. Phytolaccagenin's mechanism of action and its interactions with biological systems are subjects of ongoing research, particularly in the context of its therapeutic potential and safety profile. As with many natural products, the extraction and purification processes can influence its availability and efficacy in research and potential applications.
Formula:C31H48O7
InChI:InChI=1S/C31H48O7/c1-26(25(37)38-6)11-13-31(24(35)36)14-12-29(4)18(19(31)15-26)7-8-22-27(2)16-20(33)23(34)28(3,17-32)21(27)9-10-30(22,29)5/h7,19-23,32-34H,8-17H2,1-6H3,(H,35,36)/t19-,20-,21+,22+,23-,26-,27-,28-,29+,30+,31-/m0/s1
InChI key:InChIKey=CYJWWQALTIKOAG-FLORRLIPSA-N
SMILES:C[C@]12C([C@]3([C@@](C(O)=O)(CC1)CC[C@@](C(OC)=O)(C)C3)[H])=CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)C[C@H](O)[C@H](O)[C@]5(CO)C)[H])[H]
Synonyms:- (2beta,3beta,4alpha,20beta)-29-Methyl 2,3,23-trihydroxyolean-12-ene-28,29-dioate
- 2,3,23-Trihydroxy-29-Methoxy-29-Oxoolean-12-En-28-Oic Acid
- Jaligonic acid 30-methyl ester
- NSC 116453
- Olean-12-ene-28,29-dioic acid, 2,3,23-trihydroxy-, 29-methyl ester, (2beta,3beta,4alpha,20beta)-
- Olean-12-ene-28,29-dioic acid, 2,3,23-trihydroxy-, 29-methyl ester, (2β,3β,4α,20β)-
- Olean-12-ene-28,30-dioic acid, 2β,3β,23-trihydroxy-, 30-methyl ester
- Phytolaccagenine
- Phytolaccagenin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Olean-12-ene-28,29-dioic acid, 2,3,23-trihydroxy-, 29-methyl ester, (2β,3β,4α,20β)-
CAS:Formula:C31H48O7Purity:99%Color and Shape:SolidMolecular weight:532.7086Phytolaccagenin
CAS:Phytolaccagenin has promising antifungal activity against ATCC standard cultures of Candida albicans and Cryptococcus neoformans, and against clinical isolates of these fungi, it also shows inhibitory effects on lipopolysaccharide-induced NO production, and haemolytic activities.Formula:C31H48O7Purity:95%~99%Molecular weight:532.718Phytolaccagenin
CAS:<p>Phytolaccagenin: active, anti-inflammatory triterpenoid saponin in Radix Phtolaccae, popular in East Asia.</p>Formula:C31H48O7Purity:99.41% - 99.66%Color and Shape:SolidMolecular weight:532.71Phytolaccagenin
CAS:Carboxylic acid with additional oxygen functionsFormula:C31H48O7Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:532.72Phytolaccagenin
CAS:<p>Applications Phytolaccagenin (CAS# 1802-12-6) is a saponin found in Phytolacca acinosa and Phytolacca americana species which have antiproliferative activities in humans.<br>References Saleri, F. D.; et al.: Molecules, 22, 1077 (2017).<br></p>Formula:C31H48O7Color and Shape:NeatMolecular weight:532.71Phytolaccagenin
CAS:Controlled Product<p>Phytolaccagenin is a naturally occurring triterpenoid saponin, which is primarily sourced from the roots of the Phytolacca species, commonly known as pokeweed. This compound is characterized by its unique molecular structure, which contributes to its potent bioactivity. Phytolaccagenin exhibits its mode of action through modulation of various biological pathways, including anti-inflammatory, antiviral, and antitumor activities. This is achieved by interacting with cellular membranes, potentially leading to apoptosis in cancer cells or inhibition of viral replication.</p>Formula:C31H48O7Purity:Min. 95%Color and Shape:PowderMolecular weight:532.71 g/mol
