CAS 180205-28-1

1-(aminomethyl)cyclobutan-1-ol

Description:

1-(Aminomethyl)cyclobutan-1-ol is a cyclic organic compound characterized by the presence of both an amine and an alcohol functional group. Its structure features a cyclobutane ring, which consists of four carbon atoms arranged in a square planar configuration, with an amino group (-NH2) and a hydroxyl group (-OH) attached to the same carbon atom. This unique arrangement imparts specific chemical properties, such as the ability to participate in hydrogen bonding due to the hydroxyl group, which can enhance its solubility in polar solvents. The amino group can also engage in hydrogen bonding and may influence the compound's reactivity and interaction with other molecules. The presence of both functional groups suggests potential applications in pharmaceuticals or as intermediates in organic synthesis. Additionally, the compound's relatively small size and cyclic structure may contribute to its stability and reactivity under various conditions. Overall, 1-(aminomethyl)cyclobutan-1-ol is a versatile compound with interesting chemical properties that warrant further exploration in various chemical contexts.

Formula: C₅H₁₁NO

InChI: InChI=1/C5H11NO/c6-4-5(7)2-1-3-5/h7H,1-4,6H2

SMILES: C1CC(C1)(CN)O

Synonyms:

• Cyclobutanol, 1-(Aminomethyl)-
• 1-(Aminomethyl)Cyclobutanol

Cyclobutanol, 1-(aminomethyl)-

CAS: 180205-28-1

Formula: C₅H₁₁NO

Purity: 97%

Color and Shape: Solid

Molecular weight: 101.1469

Ref: IN-DA0021SM

1-(Aminomethyl)cyclobutanol

CAS: 180205-28-1

1-(Aminomethyl)cyclobutanol

Purity: 98%

Molecular weight: 101.15g/mol

Ref: 54-OR93938

1-(Aminomethyl)cyclobutanol

CAS: 180205-28-1

Formula: C₅H₁₁NO

Purity: 95%

Color and Shape: Solid, Pale-yellow to yellow-brown solid

Molecular weight: 101.149

Ref: 10-F091651