CAS 180258-96-2

2-(1-adamantyl)pyrrolidine hydrochloride

Description:

2-(1-Adamantyl)pyrrolidine hydrochloride is a chemical compound characterized by its unique structure, which combines a pyrrolidine ring with an adamantyl group. The adamantyl moiety contributes to its rigidity and hydrophobic properties, while the pyrrolidine ring introduces basic nitrogen functionality. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, including medicinal chemistry and pharmacological research. It is known for its potential interactions with neurotransmitter systems, particularly in the context of studying cognitive and behavioral effects. The compound's molecular structure allows for specific conformational flexibility, which can influence its biological activity. As with many organic compounds, safety and handling precautions are essential, as it may exhibit toxicity or other hazardous properties. Overall, 2-(1-adamantyl)pyrrolidine hydrochloride represents a fascinating subject of study due to its structural characteristics and potential applications in drug development.

Formula: C₁₄H₂₄ClN

InChI: InChI=1/C14H23N.ClH/c1-2-13(15-3-1)14-7-10-4-11(8-14)6-12(5-10)9-14;/h10-13,15H,1-9H2;1H

SMILES: C1CC(C23CC4CC(CC(C4)C3)C2)NC1.Cl

2-(1-Adamantyl)pyrrolidine hydrochloride

CAS: 180258-96-2

Please enquire for more information about 2-(1-Adamantyl)pyrrolidine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₂₃N

Purity: Min. 95%

Molecular weight: 205.34 g/mol

Ref: 3D-FA118143