CAS 180340-64-1

5,6,7,8-Tetrahydro-5-oxo-4H-furo[3,2-b]azepine-3-carboxylic acid

Description:

5,6,7,8-Tetrahydro-5-oxo-4H-furo[3,2-b]azepine-3-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a furan and an azepine ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the tetrahydro moiety indicates that the compound is saturated, which can influence its physical properties, such as solubility and stability. The oxo group (carbonyl) enhances the compound's reactivity, making it a potential candidate for various chemical transformations. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can interact with biological targets. Additionally, the compound's unique framework may exhibit interesting biological activities, warranting further investigation into its pharmacological properties. Overall, 5,6,7,8-Tetrahydro-5-oxo-4H-furo[3,2-b]azepine-3-carboxylic acid represents a fascinating subject for research in organic and medicinal chemistry.

Formula: C₉H₉NO₄

InChI: InChI=1S/C9H9NO4/c11-7-3-1-2-6-8(10-7)5(4-14-6)9(12)13/h4H,1-3H2,(H,10,11)(H,12,13)

InChI key: InChIKey=FJXIXGUIQHTUSS-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(OC1)CCCC(=O)N2

Synonyms:

• 4H-Furo[3,2-b]azepine-3-carboxylic acid, 5,6,7,8-tetrahydro-5-oxo-
• 5,6,7,8-Tetrahydro-5-oxo-4H-furo[3,2-b]azepine-3-carboxylic acid

5-Oxo-4H,5H,6H,7H,8H-furo[3,2-b]azepine-3-carboxylic acid

CAS: 180340-64-1

Versatile small molecule scaffold

Formula: C₉H₉NO₄

Purity: Min. 95%

Molecular weight: 195.17 g/mol

Ref: 3D-FHA34064