CymitQuimica logo

CAS 18035-74-0

:

1,1′-(Dichlorosilylene)bis[cyclohexane]

Description:
1,1′-(Dichlorosilylene)bis[cyclohexane], with CAS number 18035-74-0, is an organosilicon compound characterized by the presence of a dichlorosilylene group bonded to two cyclohexane rings. This compound typically exhibits a colorless to pale yellow appearance and is known for its relatively low volatility. The dichlorosilylene moiety contributes to its reactivity, particularly in terms of its ability to participate in further chemical reactions, such as polymerization or cross-linking processes. The cyclohexane rings provide a hydrophobic character, which can influence the solubility and interaction of the compound with other substances. Additionally, the presence of chlorine atoms can enhance its reactivity, making it useful in various synthetic applications. The compound's structure allows for potential applications in materials science, particularly in the development of silicone-based polymers and coatings. Safety considerations should be taken into account due to the presence of chlorine, which can pose health hazards if not handled properly.
Formula:C12H22Cl2Si
InChI:InChI=1S/C12H22Cl2Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h11-12H,1-10H2
InChI key:InChIKey=IESPKCNRKMAVIB-UHFFFAOYSA-N
SMILES:[Si](Cl)(Cl)(C1CCCCC1)C2CCCCC2
Synonyms:
  • 1,1′-(Dichlorosilylene)bis[cyclohexane]
  • Cyclohexane, 1,1′-(dichlorosilylene)bis-
  • Dichloro(Dicyclohexyl)Silane
  • Silane, dichlorodicyclohexyl-
  • Dicyclohexyldichlorosilane
Found 3 products.