CAS 1803561-13-8

Furo[3,2-b]pyridine-2-carboxylic acid, octahydro-5-methyl-, methyl ester, hydrochloride (1:1)

Description:

Furo[3,2-b]pyridine-2-carboxylic acid, octahydro-5-methyl-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex bicyclic structure, which includes a fused furan and pyridine ring system. This compound features a carboxylic acid moiety that has been esterified with a methyl group, contributing to its solubility and reactivity. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility in aqueous environments. The octahydro-5-methyl designation suggests that the compound has a saturated ring system with a methyl substituent, which can influence its biological activity and interaction with other molecules. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on further studies, including its interaction with biological targets and its pharmacokinetic profile. As with many chemical substances, safety data and handling precautions should be reviewed before use.

Formula: C₁₀H₁₇NO₃·ClH

InChI: InChI=1S/C10H17NO3.ClH/c1-6-3-4-8-7(11-6)5-9(14-8)10(12)13-2;/h6-9,11H,3-5H2,1-2H3;1H

InChI key: InChIKey=JNNPOVKZKNFHCP-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1OC2C(C1)NC(C)CC2.Cl

Synonyms:

• Furo[3,2-b]pyridine-2-carboxylic acid, octahydro-5-methyl-, methyl ester, hydrochloride (1:1)

Methyl 5-methyl-octahydrofuro[3,2-b]pyridine-2-carboxylate hydrochloride

CAS: 1803561-13-8

Versatile small molecule scaffold

Formula: C₁₀H₁₈ClNO₃

Purity: Min. 95%

Molecular weight: 235.71 g/mol

Ref: 3D-DXC56113