CAS 1803561-47-8

S-(Cyclopentylmethyl) ethanethioate

Description:

S-(Cyclopentylmethyl) ethanethioate is an organic compound characterized by its thioester functional group, which is derived from ethanethiol and cyclopentylmethyl alcohol. This compound typically exhibits a moderate to low polarity due to the presence of the thioester linkage, which influences its solubility in various organic solvents. The cyclopentylmethyl group contributes to its hydrophobic characteristics, potentially affecting its reactivity and interactions with other molecules. S-(Cyclopentylmethyl) ethanethioate may have applications in organic synthesis, particularly in the formation of more complex molecules, and could serve as a building block in the development of pharmaceuticals or agrochemicals. Its stability and reactivity can be influenced by factors such as temperature and the presence of nucleophiles, making it an interesting subject for study in synthetic organic chemistry. As with many thioesters, it may also exhibit distinct olfactory properties, which could be relevant in flavor and fragrance applications. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₁₄OS

InChI: InChI=1S/C8H14OS/c1-7(9)10-6-8-4-2-3-5-8/h8H,2-6H2,1H3

InChI key: InChIKey=ZYVWJBRFIFPYKI-UHFFFAOYSA-N

SMILES: C(SC(C)=O)C1CCCC1

Synonyms:

• Ethanethioic acid, S-(cyclopentylmethyl) ester
• S-(Cyclopentylmethyl) ethanethioate

1-[(Cyclopentylmethyl)sulfanyl]ethan-1-one

CAS: 1803561-47-8

Versatile small molecule scaffold

Formula: C₈H₁₄OS

Purity: Min. 95%

Molecular weight: 158.26 g/mol

Ref: 3D-DXC56147