CAS 1803561-71-8

Benzenemethanamine, 2-methoxy-6-(trifluoromethoxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 2-methoxy-6-(trifluoromethoxy)-, hydrochloride (1:1), with the CAS number 1803561-71-8, is a chemical compound characterized by its aromatic amine structure, which includes a benzene ring substituted with a methoxy group and a trifluoromethoxy group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in pharmaceutical and chemical research. The presence of the trifluoromethoxy group imparts unique electronic properties, potentially influencing the compound's reactivity and biological activity. As an amine, it may participate in hydrogen bonding and act as a nucleophile in chemical reactions. The hydrochloride form is often utilized in drug formulations due to its stability and ease of handling. Overall, this compound's specific characteristics, including its molecular structure and functional groups, contribute to its potential utility in medicinal chemistry and related fields.

Formula: C₉H₁₀F₃NO₂·ClH

InChI: InChI=1S/C9H10F3NO2.ClH/c1-14-7-3-2-4-8(6(7)5-13)15-9(10,11)12;/h2-4H,5,13H2,1H3;1H

InChI key: InChIKey=UURHCRQCZBMKNI-UHFFFAOYSA-N

SMILES: O(C(F)(F)F)C1=C(CN)C(OC)=CC=C1.Cl

Synonyms:

• Benzenemethanamine, 2-methoxy-6-(trifluoromethoxy)-, hydrochloride (1:1)

[2-Methoxy-6-(trifluoromethoxy)phenyl]methanamine hydrochloride

CAS: 1803561-71-8

Versatile small molecule scaffold

Formula: C₉H₁₁ClF₃NO₂

Purity: Min. 95%

Molecular weight: 257.64 g/mol

Ref: 3D-DXC56171