CAS 1803561-73-0

9-Oxa-1-azaspiro[5.5]undecan-2-one, 5-amino-, hydrochloride (1:1)

Description:

9-Oxa-1-azaspiro[5.5]undecan-2-one, 5-amino-, hydrochloride (1:1) is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a spiro linkage that connects a five-membered and a seven-membered ring, contributing to its rigidity and potential biological activity. The presence of an amino group enhances its reactivity and may facilitate interactions with biological targets, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water than its free base form, which can be advantageous for pharmaceutical applications. The compound's molecular structure suggests potential uses in drug development, particularly in areas targeting central nervous system disorders or other therapeutic applications. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is handled and stored. Overall, this compound represents a class of spirocyclic compounds that may exhibit interesting pharmacological properties.

Formula: C₉H₁₆N₂O₂·ClH

InChI: InChI=1S/C9H16N2O2.ClH/c10-7-1-2-8(12)11-9(7)3-5-13-6-4-9;/h7H,1-6,10H2,(H,11,12);1H

InChI key: InChIKey=NCZQEOXQCGNIOW-UHFFFAOYSA-N

SMILES: NC1C2(NC(=O)CC1)CCOCC2.Cl

Synonyms:

• 9-Oxa-1-azaspiro[5.5]undecan-2-one, 5-amino-, hydrochloride (1:1)

5-Amino-9-oxa-1-azaspiro[5.5]undecan-2-one hydrochloride

CAS: 1803561-73-0

Versatile small molecule scaffold

Formula: C₉H₁₇ClN₂O₂

Purity: Min. 95%

Molecular weight: 220.69 g/mol

Ref: 3D-DXC56173