CAS 1803561-82-1

Norleucine, 3-hydroxy-5,5-dimethyl-, hydrochloride (1:1)

Description:

Norleucine, 3-hydroxy-5,5-dimethyl-, hydrochloride (1:1) is a synthetic amino acid derivative characterized by its unique structural features. It is a hydrochloride salt, which indicates that it is a protonated form of the base compound, enhancing its solubility in water. The presence of a hydroxyl group and two methyl groups on the side chain contributes to its hydrophilic and lipophilic properties, respectively. This compound is often studied for its potential applications in biochemistry and pharmacology, particularly in the context of protein synthesis and metabolic pathways. Its structural similarity to natural amino acids allows it to participate in various biochemical reactions, making it a valuable tool in research. Additionally, the hydrochloride form typically improves stability and handling characteristics, making it easier to work with in laboratory settings. As with many amino acid derivatives, it may exhibit specific biological activities, although detailed studies are necessary to elucidate its full range of effects and potential applications.

Formula: C₈H₁₇NO₃·ClH

InChI: InChI=1S/C8H17NO3.ClH/c1-8(2,3)4-5(10)6(9)7(11)12;/h5-6,10H,4,9H2,1-3H3,(H,11,12);1H

InChI key: InChIKey=ODCSPVSRZKOFFB-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)N)(CC(C)(C)C)O.Cl

Synonyms:

• Norleucine, 3-hydroxy-5,5-dimethyl-, hydrochloride (1:1)

2-Amino-3-hydroxy-5,5-dimethylhexanoic acid hydrochloride

CAS: 1803561-82-1

Versatile small molecule scaffold

Formula: C₈H₁₈ClNO₃

Purity: Min. 95%

Molecular weight: 211.68 g/mol

Ref: 3D-DXC56182