CAS 1803561-93-4

Benzenepropanamide, 4-amino-N-hydroxy-, hydrochloride (1:1)

Description:

Benzenepropanamide, 4-amino-N-hydroxy-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from benzene and propanoic acid. The presence of an amino group and a hydroxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability for medicinal applications. The compound may exhibit properties such as being a potential inhibitor or modulator in various biochemical pathways, although specific mechanisms would depend on its structural interactions at the molecular level. Its CAS number, 1803561-93-4, allows for precise identification in chemical databases and literature. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, this compound represents a class of organic molecules that may have implications in medicinal chemistry and therapeutic development.

Formula: C₉H₁₂N₂O₂·ClH

InChI: InChI=1S/C9H12N2O2.ClH/c10-8-4-1-7(2-5-8)3-6-9(12)11-13;/h1-2,4-5,13H,3,6,10H2,(H,11,12);1H

InChI key: InChIKey=ZQZDWJSVBDQOIN-UHFFFAOYSA-N

SMILES: C(CC(NO)=O)C1=CC=C(N)C=C1.Cl

Synonyms:

• Benzenepropanamide, 4-amino-N-hydroxy-, hydrochloride (1:1)

3-(4-Aminophenyl)-N-hydroxypropanamide hydrochloride

CAS: 1803561-93-4

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 216.66 g/mol

Ref: 3D-DXC56193