CAS 1803562-31-3

3-Piperidineacetic acid, α,α,1-trimethyl-, hydrochloride (1:1)

Description:

3-Piperidineacetic acid, α,α,1-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The presence of trimethyl groups on the α-carbon indicates steric hindrance, which can affect the compound's conformation and, consequently, its pharmacological properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound may exhibit properties such as being a potential ligand for receptors or enzymes, and its structure suggests it could be involved in neurotransmitter modulation or other biological pathways. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c1-10(2,9(12)13)8-5-4-6-11(3)7-8;/h8H,4-7H2,1-3H3,(H,12,13);1H

InChI key: InChIKey=GJRJHVHHMQPNGW-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)(C)C1CN(C)CCC1.Cl

Synonyms:

• 3-Piperidineacetic acid, α,α,1-trimethyl-, hydrochloride (1:1)

2-Methyl-2-(1-methylpiperidin-3-yl)propanoic acid hydrochloride

CAS: 1803562-31-3

Versatile small molecule scaffold

Formula: C₁₀H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 221.72 g/mol

Ref: 3D-DXC56231