CAS 1803562-43-7

5-Isoxazoleethanamine, 3-methyl-, hydrochloride (1:1)

Description:

5-Isoxazoleethanamine, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which contributes to its unique reactivity and biological properties. This compound features an ethylamine side chain, which enhances its potential as a pharmacological agent. The hydrochloride salt form indicates that it is a hydrochloride, which typically improves solubility in water and stability. Isoxazole derivatives are often studied for their applications in medicinal chemistry, particularly for their roles in neuropharmacology and as potential therapeutic agents. The presence of the methyl group at the 3-position of the isoxazole ring can influence the compound's interaction with biological targets, potentially affecting its efficacy and selectivity. As with many amines, the compound may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further research is necessary to fully elucidate its biological activity and potential applications in various fields.

Formula: C₆H₁₀N₂O·ClH

InChI: InChI=1S/C6H10N2O.ClH/c1-5-4-6(2-3-7)9-8-5;/h4H,2-3,7H2,1H3;1H

InChI key: InChIKey=NNXGZVPOCVXQLI-UHFFFAOYSA-N

SMILES: C(CN)C1=CC(C)=NO1.Cl

Synonyms:

• 5-Isoxazoleethanamine, 3-methyl-, hydrochloride (1:1)
• 2-(3-Methyl-1,2-oxazol-5-yl)ethan-1-amine hydrochloride

2-(3-Methyl-1,2-oxazol-5-yl)ethan-1-amine hydrochloride

CAS: 1803562-43-7

Versatile small molecule scaffold

Formula: C₆H₁₁ClN₂O

Purity: Min. 95%

Molecular weight: 162.62 g/mol

Ref: 3D-DXC56243