CAS 1803562-51-7

2-Pyridinecarboxamide, N-methyl-4-(3-piperidinyloxy)-, hydrochloride (1:2)

Description:

2-Pyridinecarboxamide, N-methyl-4-(3-piperidinyloxy)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a pyridine ring and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The presence of the piperidinyloxy group suggests potential biological activity, possibly as a pharmacological agent, although specific biological properties would depend on further studies. The compound's molecular structure indicates it may engage in hydrogen bonding and other intermolecular interactions, which can influence its reactivity and solubility. As with many nitrogen-containing heterocycles, it may exhibit basic properties, making it relevant in medicinal chemistry and drug design. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₂H₁₇N₃O₂·2ClH

InChI: InChI=1S/C12H17N3O2.2ClH/c1-13-12(16)11-7-9(4-6-15-11)17-10-3-2-5-14-8-10;;/h4,6-7,10,14H,2-3,5,8H2,1H3,(H,13,16);2*1H

InChI key: InChIKey=NMVVWNFPTFSXOQ-UHFFFAOYSA-N

SMILES: O(C=1C=C(C(NC)=O)N=CC1)C2CCCNC2.Cl

Synonyms:

• 2-Pyridinecarboxamide, N-methyl-4-(3-piperidinyloxy)-, hydrochloride (1:2)

N-Methyl-4-(piperidin-3-yloxy)pyridine-2-carboxamide dihydrochloride

CAS: 1803562-51-7

Versatile small molecule scaffold

Formula: C₁₂H₁₉Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 308.2 g/mol

Ref: 3D-DXC56251