CAS 1803562-59-5

1,2-Ethanediamine, N1,N2-dicyclopropyl-N1-methyl-, hydrochloride (1:2)

Description:

1,2-Ethanediamine, N1,N2-dicyclopropyl-N1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its amine functional groups and cyclopropyl substituents. It features a central ethanediamine backbone, which is a two-carbon chain with amino groups at both ends, modified by two cyclopropyl groups and a methyl group attached to one of the nitrogen atoms. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and stability. This compound is likely to exhibit basic properties due to the presence of amine groups, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. Its unique structure may contribute to specific biological activities, although detailed studies would be necessary to elucidate its pharmacological properties. Safety data and handling precautions should be considered, as with any chemical substance, particularly those involving amines, which can be reactive and may pose health risks if not managed properly.

Formula: C₉H₁₈N₂·2ClH

InChI: InChI=1S/C9H18N2.2ClH/c1-11(9-4-5-9)7-6-10-8-2-3-8;;/h8-10H,2-7H2,1H3;2*1H

InChI key: InChIKey=ORTALJJESBWWBO-UHFFFAOYSA-N

SMILES: N(CCNC1CC1)(C)C2CC2.Cl

Synonyms:

• 1,2-Ethanediamine, N1,N2-dicyclopropyl-N1-methyl-, hydrochloride (1:2)

N-[2-(Cyclopropylamino)ethyl]-N-methylcyclopropanamine dihydrochloride

CAS: 1803562-59-5

Versatile small molecule scaffold

Formula: C₉H₂₀Cl₂N₂

Purity: Min. 95%

Molecular weight: 227.17 g/mol

Ref: 3D-DXC56259