CAS 1803565-56-1

Benzeneacetic acid, α-amino-3-fluoro-4-methoxy-, ethyl ester, hydrochloride (1:1)

Description:

Benzeneacetic acid, α-amino-3-fluoro-4-methoxy-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring, an acetic acid moiety, and an ethyl ester functional group. The presence of an amino group and a fluorine atom contributes to its potential biological activity and pharmacological properties. The methoxy group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including pharmaceutical formulations. The compound's specific interactions and reactivity can be influenced by the functional groups present, which may also affect its role in biochemical pathways or therapeutic uses. Overall, this compound's unique combination of functional groups suggests potential utility in medicinal chemistry, particularly in the development of novel therapeutic agents.

Formula: C₁₁H₁₄FNO₃·ClH

InChI: InChI=1S/C11H14FNO3.ClH/c1-3-16-11(14)10(13)7-4-5-9(15-2)8(12)6-7;/h4-6,10H,3,13H2,1-2H3;1H

InChI key: InChIKey=GKOWJFGJEGEGLK-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(N)C1=CC(F)=C(OC)C=C1.Cl

Synonyms:

• Benzeneacetic acid, α-amino-3-fluoro-4-methoxy-, ethyl ester, hydrochloride (1:1)

Ethyl 2-amino-2-(3-fluoro-4-methoxyphenyl)acetate hydrochloride

CAS: 1803565-56-1

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClFNO₃

Purity: Min. 95%

Molecular weight: 263.69 g/mol

Ref: 3D-DXC56556