CAS 1803565-88-9

7-Isoquinolinamine, 1,2,3,4-tetrahydro-N,N-dimethyl-, hydrochloride (1:2)

Description:

7-Isoquinolinamine, 1,2,3,4-tetrahydro-N,N-dimethyl-, hydrochloride (1:2) is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound. This substance features a tetrahydroisoquinoline moiety, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of the dimethylamino group suggests that it has basic properties, allowing it to form a hydrochloride salt, which enhances its solubility in water and stability. The hydrochloride form typically indicates that the compound is a protonated version of the base, which can influence its pharmacological properties. This compound may exhibit biological activity, potentially making it of interest in medicinal chemistry and drug development. Its specific interactions and applications would depend on further research into its pharmacodynamics and pharmacokinetics. As with many chemical substances, safety data and handling precautions should be considered, particularly due to the presence of nitrogen-containing functional groups that may have implications for toxicity and reactivity.

Formula: C₁₁H₁₆N₂·2ClH

InChI: InChI=1S/C11H16N2.2ClH/c1-13(2)11-4-3-9-5-6-12-8-10(9)7-11;;/h3-4,7,12H,5-6,8H2,1-2H3;2*1H

InChI key: InChIKey=WNRYRHOINWHETK-UHFFFAOYSA-N

SMILES: N(C)(C)C=1C=C2C(=CC1)CCNC2.Cl

Synonyms:

• 7-Isoquinolinamine, 1,2,3,4-tetrahydro-N,N-dimethyl-, hydrochloride (1:2)

N,N-Dimethyl-1,2,3,4-tetrahydroisoquinolin-7-amine dihydrochloride

CAS: 1803565-88-9

Versatile small molecule scaffold

Formula: C₁₁H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 249.18 g/mol

Ref: 3D-DXC56588