CAS 1803566-41-7

8-Azabicyclo[3.2.1]octan-3-amine, 8-methyl-3-(trifluoromethyl)-, hydrochloride (1:2)

Description:

8-Azabicyclo[3.2.1]octan-3-amine, 8-methyl-3-(trifluoromethyl)-, hydrochloride (1:2) is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, making it a bicyclic amine. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The hydrochloride salt form indicates that the compound is protonated, which typically increases its solubility in water and may affect its pharmacokinetic properties. This compound is likely to exhibit properties typical of amines, such as basicity and potential reactivity with electrophiles. Its unique structure may confer specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 1803566-41-7, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research or pharmaceuticals. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₉H₁₅F₃N₂·2ClH

InChI: InChI=1S/C9H15F3N2.2ClH/c1-14-6-2-3-7(14)5-8(13,4-6)9(10,11)12;;/h6-7H,2-5,13H2,1H3;2*1H

InChI key: InChIKey=PHHHHVREVQFXDK-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1(N)CC2N(C)C(C1)CC2.Cl

Synonyms:

• 8-Azabicyclo[3.2.1]octan-3-amine, 8-methyl-3-(trifluoromethyl)-, hydrochloride (1:2)

8-Methyl-3-(trifluoromethyl)-8-azabicyclo[3.2.1]octan-3-amine dihydrochloride

CAS: 1803566-41-7

Versatile small molecule scaffold

Formula: C₉H₁₇Cl₂F₃N₂

Purity: Min. 95%

Molecular weight: 281.14 g/mol

Ref: 3D-DXC56641