CAS 1803566-51-9

Pentanoic acid, 2-(aminomethyl)-, ethyl ester, hydrochloride (1:1)

Description:

Pentanoic acid, 2-(aminomethyl)-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a pentanoic acid backbone with an aminomethyl group and an ethyl ester functional group. This compound is typically a white to off-white solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. It exhibits properties typical of both carboxylic acids and amines, making it a potential candidate for various applications in pharmaceuticals and organic synthesis. The presence of the amine group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the ethyl ester moiety can be hydrolyzed under certain conditions, releasing pentanoic acid and ethanol. As with many chemical substances, safety precautions should be observed when handling this compound, as it may have specific toxicity or reactivity profiles that necessitate careful management in laboratory or industrial settings.

Formula: C₈H₁₇NO₂·ClH

InChI: InChI=1S/C8H17NO2.ClH/c1-3-5-7(6-9)8(10)11-4-2;/h7H,3-6,9H2,1-2H3;1H

InChI key: InChIKey=BOQHQMXFANNCJU-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)(CCC)CN.Cl

Synonyms:

• Pentanoic acid, 2-(aminomethyl)-, ethyl ester, hydrochloride (1:1)

Ethyl 2-(aminomethyl)pentanoate hydrochloride

CAS: 1803566-51-9

Versatile small molecule scaffold

Formula: C₈H₁₈ClNO₂

Purity: Min. 95%

Molecular weight: 195.69 g/mol

Ref: 3D-DXC56651