CAS 1803566-73-5

1,2,4-Oxadiazole-5-methanamine, 3-(3-bromophenyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole-5-methanamine, 3-(3-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features a methanamine group attached to the oxadiazole, contributing to its potential as a bioactive molecule. The presence of the 3-bromophenyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, which can pose environmental and health risks.

Formula: C₉H₈BrN₃O·ClH

InChI: InChI=1S/C9H8BrN3O.ClH/c10-7-3-1-2-6(4-7)9-12-8(5-11)14-13-9;/h1-4H,5,11H2;1H

InChI key: InChIKey=FDBFQFPJPNLCIL-UHFFFAOYSA-N

SMILES: C(N)C1=NC(=NO1)C2=CC(Br)=CC=C2.Cl

Synonyms:

• 1,2,4-Oxadiazole-5-methanamine, 3-(3-bromophenyl)-, hydrochloride (1:1)

[3-(3-Bromophenyl)-1,2,4-oxadiazol-5-yl]methanamine hydrochloride

CAS: 1803566-73-5

Versatile small molecule scaffold

Formula: C₉H₉BrClN₃O

Purity: Min. 95%

Molecular weight: 290.54 g/mol

Ref: 3D-DXC56673