CAS 1803566-89-3

Methyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate

Description:

Methyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which incorporates bromine substituents at the 2 and 3 positions of the imidazole ring. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of bromine atoms enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methyl ester group provides solubility in organic solvents and can be hydrolyzed to yield the corresponding carboxylic acid. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, which could lead to the discovery of new therapeutic agents. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.

Formula: C₉H₆Br₂N₂O₂

InChI: InChI=1S/C9H6Br2N2O2/c1-15-9(14)5-2-3-6-12-7(10)8(11)13(6)4-5/h2-4H,1H3

InChI key: InChIKey=BLSVWRKNCDRNCC-UHFFFAOYSA-N

SMILES: BrC=1N2C(=NC1Br)C=CC(C(OC)=O)=C2

Synonyms:

• Methyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate
• Imidazo[1,2-a]pyridine-6-carboxylic acid, 2,3-dibromo-, methyl ester

Methyl 2,3-dibromoimidazo[1,2-a]pyridine-6-carboxylate

CAS: 1803566-89-3

Versatile small molecule scaffold

Formula: C₉H₆Br₂N₂O₂

Purity: Min. 95%

Molecular weight: 333.96 g/mol

Ref: 3D-DXC56689