CAS 1803567-10-3

Ethanone, 1-(2-amino-6-methoxyphenyl)-, hydrochloride (1:1)

Description:

Ethanone, 1-(2-amino-6-methoxyphenyl)-, hydrochloride (1:1), also known by its CAS number 1803567-10-3, is a chemical compound characterized by its structure, which includes an ethanone moiety and an amino group attached to a methoxy-substituted phenyl ring. This compound typically appears as a hydrochloride salt, indicating it is a protonated form that enhances its solubility in water. The presence of the amino group suggests potential basic properties, while the methoxy group may influence its electronic characteristics and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its hydrochloride form is commonly utilized in various applications, including drug formulation and synthesis. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry.

Formula: C₉H₁₁NO₂·ClH

InChI: InChI=1S/C9H11NO2.ClH/c1-6(11)9-7(10)4-3-5-8(9)12-2;/h3-5H,10H2,1-2H3;1H

InChI key: InChIKey=MXFGMXDSHAETIC-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(OC)C=CC=C1N.Cl

Synonyms:

• Ethanone, 1-(2-amino-6-methoxyphenyl)-, hydrochloride (1:1)

1-(2-Amino-6-methoxyphenyl)ethan-1-one hydrochloride

CAS: 1803567-10-3

Versatile small molecule scaffold

Formula: C₉H₁₂ClNO₂

Purity: Min. 95%

Molecular weight: 201.65 g/mol

Ref: 3D-DXC56710