CAS 1803567-39-6

Piperidine, 2-[5-(tetrahydro-2H-pyran-4-yl)-1,3,4-oxadiazol-2-yl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[5-(tetrahydro-2H-pyran-4-yl)-1,3,4-oxadiazol-2-yl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a 1,3,4-oxadiazole moiety contributes to its potential biological activity, as oxadiazoles are often associated with pharmacological properties. The tetrahydro-2H-pyran group adds to the compound's structural complexity and may influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for various applications, including medicinal chemistry. The compound may exhibit properties such as antimicrobial, anti-inflammatory, or analgesic activities, although specific biological effects would depend on further empirical studies. Its molecular structure suggests potential interactions with biological targets, making it a candidate for drug development. Safety and handling precautions should be observed, as with all chemical substances, particularly those with unknown toxicity profiles.

Formula: C₁₂H₁₉N₃O₂·ClH

InChI: InChI=1S/C12H19N3O2.ClH/c1-2-6-13-10(3-1)12-15-14-11(17-12)9-4-7-16-8-5-9;/h9-10,13H,1-8H2;1H

InChI key: InChIKey=RFEKOFVUYXHXDI-UHFFFAOYSA-N

SMILES: C=1(OC(=NN1)C2CCCCN2)C3CCOCC3.Cl

Synonyms:

• Piperidine, 2-[5-(tetrahydro-2H-pyran-4-yl)-1,3,4-oxadiazol-2-yl]-, hydrochloride (1:1)

2-[5-(Oxan-4-yl)-1,3,4-oxadiazol-2-yl]piperidine hydrochloride

CAS: 1803567-39-6

Versatile small molecule scaffold

Formula: C₁₂H₂₀ClN₃O₂

Purity: Min. 95%

Molecular weight: 273.76 g/mol

Ref: 3D-DXC56739