CAS 1803567-42-1

2H-1,2-Benzothiazin-3(4H)-one, 6-bromo-, 1,1-dioxide

Description:

2H-1,2-Benzothiazin-3(4H)-one, 6-bromo-, 1,1-dioxide is a chemical compound characterized by its unique structure, which includes a benzothiazine core with a bromine substituent and a sulfone group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the bromine atom may influence its reactivity and solubility, while the 1,1-dioxide functional group suggests the potential for oxidation reactions. Compounds of this class are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2H-1,2-Benzothiazin-3(4H)-one, 6-bromo-, 1,1-dioxide represents a significant area of research due to its potential applications in drug development and therapeutic interventions.

Formula: C₈H₆BrNO₃S

InChI: InChI=1S/C8H6BrNO3S/c9-6-1-2-7-5(3-6)4-8(11)10-14(7,12)13/h1-3H,4H2,(H,10,11)

InChI key: InChIKey=ZUDCVPVAVABRMH-UHFFFAOYSA-N

SMILES: O=S1(=O)C=2C(CC(=O)N1)=CC(Br)=CC2

Synonyms:

• 2H-1,2-Benzothiazin-3(4H)-one, 6-bromo-, 1,1-dioxide

6-Bromo-3,4-dihydro-2H-1,2-benzothiazine-1,1,3-trione

CAS: 1803567-42-1

Versatile small molecule scaffold

Formula: C₈H₆BrNO₃S

Purity: Min. 95%

Molecular weight: 276.11 g/mol

Ref: 3D-DXC56742