CAS 1803567-54-5

Benzoic acid, 2-(4-pyridinyloxy)-, hydrochloride (1:1)

Description:

Benzoic acid, 2-(4-pyridinyloxy)-, hydrochloride (1:1) is a chemical compound characterized by its benzoic acid structure modified with a pyridinyloxy group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride moiety, which enhances its solubility compared to its free acid form. The presence of the pyridinyloxy group suggests potential applications in pharmaceuticals, particularly as a ligand or in drug formulation, due to its ability to interact with biological targets. The hydrochloride form indicates that it is a salt, which can influence its stability and bioavailability. Additionally, this compound may exhibit acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₂H₉NO₃·ClH

InChI: InChI=1S/C12H9NO3.ClH/c14-12(15)10-3-1-2-4-11(10)16-9-5-7-13-8-6-9;/h1-8H,(H,14,15);1H

InChI key: InChIKey=ISTVYWHBDJLERG-UHFFFAOYSA-N

SMILES: O(C1=C(C(O)=O)C=CC=C1)C=2C=CN=CC2.Cl

Synonyms:

• Benzoic acid, 2-(4-pyridinyloxy)-, hydrochloride (1:1)

2-(Pyridin-4-yloxy)benzoic acid hydrochloride

CAS: 1803567-54-5

Versatile small molecule scaffold

Formula: C₁₂H₁₀ClNO₃

Purity: Min. 95%

Molecular weight: 251.66 g/mol

Ref: 3D-DXC56754