CAS 1803567-64-7

Proline, 3-(4-methylphenyl)-, hydrochloride (1:1)

Description:

Proline, 3-(4-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a proline backbone with a 4-methylphenyl substituent at the 3-position. This compound is a hydrochloride salt, indicating that it is the hydrochloride form of the base compound, which enhances its solubility in water and may influence its stability and bioavailability. Proline is an amino acid that plays a crucial role in protein synthesis and is known for its unique cyclic structure, which contributes to the stability of protein conformations. The presence of the 4-methylphenyl group introduces hydrophobic characteristics, potentially affecting the compound's interactions in biological systems. As a hydrochloride, it typically appears as a white crystalline solid. This compound may have applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. However, detailed studies on its pharmacological properties, toxicity, and specific applications would be necessary to fully understand its potential uses.

Formula: C₁₂H₁₅NO₂·ClH

InChI: InChI=1S/C12H15NO2.ClH/c1-8-2-4-9(5-3-8)10-6-7-13-11(10)12(14)15;/h2-5,10-11,13H,6-7H2,1H3,(H,14,15);1H

InChI key: InChIKey=BVCKXFIMGBFTKZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C(CCN1)C2=CC=C(C)C=C2.Cl

Synonyms:

• Proline, 3-(4-methylphenyl)-, hydrochloride (1:1)

3-(4-Methylphenyl)pyrrolidine-2-carboxylic acid hydrochloride

CAS: 1803567-64-7

Versatile small molecule scaffold

Formula: C₁₂H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 241.71 g/mol

Ref: 3D-DXC56764