CAS 1803570-14-0

1,2,4-Triazolo[4,3-a]pyrazine-6-carboxylic acid, 5,6,7,8-tetrahydro-3-methyl-, 1,1-dimethylethyl ester

Description:

1,2,4-Triazolo[4,3-a]pyrazine-6-carboxylic acid, 5,6,7,8-tetrahydro-3-methyl-, 1,1-dimethylethyl ester, identified by its CAS number 1803570-14-0, is a chemical compound characterized by its complex heterocyclic structure, which includes both triazole and pyrazine rings. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of the carboxylic acid moiety suggests it may participate in acid-base reactions, while the ester functional group indicates it can undergo hydrolysis. The tetrahydro and methyl substituents contribute to its steric and electronic properties, potentially influencing its reactivity and interaction with biological targets. Such compounds are often investigated for their pharmacological properties, including antimicrobial or anti-inflammatory activities. Additionally, the stability and solubility of this ester form may enhance its utility in medicinal chemistry and drug formulation. Overall, this compound represents a class of molecules with significant potential in pharmaceutical applications.

Formula: C₁₁H₁₈N₄O₂

InChI: InChI=1S/C11H18N4O2/c1-7-13-14-9-5-12-8(6-15(7)9)10(16)17-11(2,3)4/h8,12H,5-6H2,1-4H3

InChI key: InChIKey=CJPJLOYXBZBRPF-UHFFFAOYSA-N

SMILES: CC=1N2C(CNC(C(OC(C)(C)C)=O)C2)=NN1

Synonyms:

• 1,2,4-Triazolo[4,3-a]pyrazine-6-carboxylic acid, 5,6,7,8-tetrahydro-3-methyl-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 5,6,7,8-tetrahydro-3-methyl-1,2,4-triazolo[4,3-a]pyrazine-6-carboxylate

tert-Butyl 3-methyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyrazine-6-carboxylate

CAS: 1803570-14-0

Versatile small molecule scaffold

Formula: C₁₁H₁₈N₄O₂

Purity: Min. 95%

Molecular weight: 238.29 g/mol

Ref: 3D-DXC57014