CAS 1803570-39-9

2-Pyrrolidinone, 5-(2-aminoethyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinone, 5-(2-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound is a hydrochloride salt, indicating that it is the hydrochloric acid salt of the base form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the aminoethyl group suggests potential biological activity, as aminoethyl derivatives are often involved in neurotransmitter functions or as intermediates in the synthesis of bioactive molecules. The compound is likely to exhibit properties typical of both amines and lactams, such as basicity and the ability to participate in hydrogen bonding. Its molecular structure may contribute to its stability and reactivity, making it a candidate for further research in medicinal chemistry or as a building block in organic synthesis. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₆H₁₂N₂O·ClH

InChI: InChI=1S/C6H12N2O.ClH/c7-4-3-5-1-2-6(9)8-5;/h5H,1-4,7H2,(H,8,9);1H

InChI key: InChIKey=HKOLXKWRLHOHLU-UHFFFAOYSA-N

SMILES: C(CN)C1NC(=O)CC1.Cl

Synonyms:

• 2-Pyrrolidinone, 5-(2-aminoethyl)-, hydrochloride (1:1)

5-(2-Aminoethyl)pyrrolidin-2-one hydrochloride

CAS: 1803570-39-9

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O

Purity: Min. 95%

Molecular weight: 164.63 g/mol

Ref: 3D-DXC57039